C54H80CuN2O8 — CID 18345862
copper bis(2-[[(10R,13S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]amino]-4-methylpentanoate) (PubChem CID 18345862) has the molecular formula C54H80CuN2O8 and a molecular weight of 948.79 g/mol. Its IUPAC name is copper bis(2-[[(10R,13S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]amino]-4-methylpentanoate).
| Compound Name | copper bis(2-[[(10R,13S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]amino]-4-methylpentanoate) |
|---|---|
| PubChem CID | 18345862 |
| Molecular Formula | C54H80CuN2O8 |
| Molecular Weight | 948.79 g/mol |
| Exact Mass | 947.52 |
| IUPAC Name | copper bis(2-[[(10R,13S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]amino]-4-methylpentanoate) |
| SMILES | CC(=O)[C@H]1CCC2C3CCC4=CC(=O)CC(NC(CC(C)C)C(=O)[O-])[C@]4(C)C3CC[C@@]21C.CC(=O)[C@H]1CCC2C3CCC4=CC(=O)CC(NC(CC(C)C)C(=O)[O-])[C@]4(C)C3CC[C@@]21C.[Cu+2] |
| InChI | InChI=1S/2C27H41NO4.Cu/c2*1-15(2)12-23(25(31)32)28-24-14-18(30)13-17-6-7-19-21-9-8-20(16(3)29)26(21,4)11-10-22(19)27(17,24)5;/h2*13,15,19-24,28H,6-12,14H2,1-5H3,(H,31,32);/q;;+2/p-2/t2*19?,20-,21?,22?,23?,24?,26-,27+;/m11./s1 |
| InChIKey | KXHSZVRVUMKLAK-KQVQCSOXSA-L |
| XLogP | 6.91 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |