C28H25GaN2O4S — CID 18346364
bis[(2-methylquinolin-8-yl)oxy]gallanyl 4-thiophen-2-ylbutanoate (PubChem CID 18346364) has the molecular formula C28H25GaN2O4S and a molecular weight of 555.31 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]gallanyl 4-thiophen-2-ylbutanoate.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]gallanyl 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 18346364 |
| Molecular Formula | C28H25GaN2O4S |
| Molecular Weight | 555.31 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]gallanyl 4-thiophen-2-ylbutanoate |
| SMILES | Cc1ccc2cccc(O[Ga](OC(=O)CCCc3cccs3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/2C10H9NO.C8H10O2S.Ga/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;9-8(10)5-1-3-7-4-2-6-11-7;/h2*2-6,12H,1H3;2,4,6H,1,3,5H2,(H,9,10);/q;;;+3/p-3 |
| InChIKey | RARUXWNOMMLZQK-UHFFFAOYSA-K |
| XLogP | 6.47 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.31 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |