About 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene
1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene (PubChem CID 18347425) has the molecular formula C23H26O
and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene.
Molecular Properties
| Compound Name | 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene |
| PubChem CID | 18347425 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene |
| SMILES | CCC(CC)(C1=CCC=C1)c1cccc(-c2ccccc2)c1OC |
| InChI | InChI=1S/C23H26O/c1-4-23(5-2,19-14-9-10-15-19)21-17-11-16-20(22(21)24-3)18-12-7-6-8-13-18/h6-9,11-17H,4-5,10H2,1-3H3 |
| InChIKey | GMIGTGHDJHQQJO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene?
The IUPAC name of 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene (CID 18347425) is 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene.
What is the SMILES notation for 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene?
The canonical SMILES for 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene is CCC(CC)(C1=CCC=C1)c1cccc(-c2ccccc2)c1OC.
What is the InChIKey of 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene?
The InChIKey is GMIGTGHDJHQQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O/c1-4-23(5-2,19-14-9-10-15-19)21-17-11-16-20(22(21)24-3)18-12-7-6-8-13-18/h6-9,11-17H,4-5,10H2,1-3H3.
What are the key properties of 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene?
1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene has a molecular weight of 318.46 g/mol, XLogP of 6.31, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclopenta-1,4-dien-1-ylpentan-3-yl)-2-methoxy-3-phenylbenzene is sourced from PubChem (CID 18347425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).