C13H14N2O — CID 18348745
2,3,4,4a,5,10-hexahydro-1H-chromeno[3,4-c]pyridine-9-carbonitrile (PubChem CID 18348745) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2,3,4,4a,5,10-hexahydro-1H-chromeno[3,4-c]pyridine-9-carbonitrile.
| Compound Name | 2,3,4,4a,5,10-hexahydro-1H-chromeno[3,4-c]pyridine-9-carbonitrile |
|---|---|
| PubChem CID | 18348745 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2,3,4,4a,5,10-hexahydro-1H-chromeno[3,4-c]pyridine-9-carbonitrile |
| SMILES | N#CC1=CC=C2OCC3CNCCC3=C2C1 |
| InChI | InChI=1S/C13H14N2O/c14-6-9-1-2-13-12(5-9)11-3-4-15-7-10(11)8-16-13/h1-2,10,15H,3-5,7-8H2 |
| InChIKey | KATGAIPSGWQIIP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |