C9H16N4 — CID 18349129
N-[2-(1,2,4-triazol-1-yl)ethyl]cyclopentanamine (PubChem CID 18349129) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(1,2,4-triazol-1-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 18349129 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-yl)ethyl]cyclopentanamine |
| SMILES | c1ncn(CCNC2CCCC2)n1 |
| InChI | InChI=1S/C9H16N4/c1-2-4-9(3-1)11-5-6-13-8-10-7-12-13/h7-9,11H,1-6H2 |
| InChIKey | MUOPWOIUIXJLFX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |