C10H19IN6 — CID 119118254
2-(cyclobutylmethyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 119118254) has the molecular formula C10H19IN6 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(cyclobutylmethyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119118254 |
| Molecular Formula | C10H19IN6 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC1)NCCn1cncn1 |
| InChI | InChI=1S/C10H18N6.HI/c11-10(14-6-9-2-1-3-9)13-4-5-16-8-12-7-15-16;/h7-9H,1-6H2,(H3,11,13,14);1H |
| InChIKey | UYMRFVYKEFNWCM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|