C8H16N4 — CID 62041881
N-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine (PubChem CID 62041881) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine.
| Compound Name | N-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 62041881 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | N-methyl-1-(1,2,4-triazol-1-yl)pentan-2-amine |
| SMILES | CCCC(Cn1cncn1)NC |
| InChI | InChI=1S/C8H16N4/c1-3-4-8(9-2)5-12-7-10-6-11-12/h6-9H,3-5H2,1-2H3 |
| InChIKey | OJXARJQOMZMJOS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |