C21H20INO5 — CID 18350627
4-(4-iodo-2-methoxyphenyl)-4-methyl-2-oxo-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide (PubChem CID 18350627) has the molecular formula C21H20INO5 and a molecular weight of 493.30 g/mol. Its IUPAC name is 4-(4-iodo-2-methoxyphenyl)-4-methyl-2-oxo-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide.
| Compound Name | 4-(4-iodo-2-methoxyphenyl)-4-methyl-2-oxo-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
|---|---|
| PubChem CID | 18350627 |
| Molecular Formula | C21H20INO5 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-(4-iodo-2-methoxyphenyl)-4-methyl-2-oxo-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
| SMILES | COc1cc(I)ccc1C(C)(C)CC(=O)C(=O)Nc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C21H20INO5/c1-21(2,16-7-4-13(22)9-18(16)27-3)10-17(24)19(25)23-14-5-6-15-12(8-14)11-28-20(15)26/h4-9H,10-11H2,1-3H3,(H,23,25) |
| InChIKey | BBHXWQQCLGDRJF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|