C28H52N2O4 — CID 18352045
2,2-bis(1,2,2,6-tetramethylpiperidin-4-yl)decanedioic acid (PubChem CID 18352045) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is 2,2-bis(1,2,2,6-tetramethylpiperidin-4-yl)decanedioic acid.
| Compound Name | 2,2-bis(1,2,2,6-tetramethylpiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 18352045 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | 2,2-bis(1,2,2,6-tetramethylpiperidin-4-yl)decanedioic acid |
| SMILES | CC1CC(C(CCCCCCCC(=O)O)(C(=O)O)C2CC(C)N(C)C(C)(C)C2)CC(C)(C)N1C |
| InChI | InChI=1S/C28H52N2O4/c1-20-16-22(18-26(3,4)29(20)7)28(25(33)34,15-13-11-9-10-12-14-24(31)32)23-17-21(2)30(8)27(5,6)19-23/h20-23H,9-19H2,1-8H3,(H,31,32)(H,33,34) |
| InChIKey | KJQMLSFJFPLULV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|