C33H48N4O4 — CID 18352959
4-methoxy-N-[3-[2-[[1-(morpholine-4-carbonyl)piperidin-4-yl]methyl-pentylamino]propyl]phenyl]benzamide (PubChem CID 18352959) has the molecular formula C33H48N4O4 and a molecular weight of 564.77 g/mol. Its IUPAC name is 4-methoxy-N-[3-[2-[[1-(morpholine-4-carbonyl)piperidin-4-yl]methyl-pentylamino]propyl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[2-[[1-(morpholine-4-carbonyl)piperidin-4-yl]methyl-pentylamino]propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18352959 |
| Molecular Formula | C33H48N4O4 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | 4-methoxy-N-[3-[2-[[1-(morpholine-4-carbonyl)piperidin-4-yl]methyl-pentylamino]propyl]phenyl]benzamide |
| SMILES | CCCCCN(CC1CCN(C(=O)N2CCOCC2)CC1)C(C)Cc1cccc(NC(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C33H48N4O4/c1-4-5-6-16-37(25-27-14-17-35(18-15-27)33(39)36-19-21-41-22-20-36)26(2)23-28-8-7-9-30(24-28)34-32(38)29-10-12-31(40-3)13-11-29/h7-13,24,26-27H,4-6,14-23,25H2,1-3H3,(H,34,38) |
| InChIKey | PAPRZCLRMXHOBX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|