C23H36N4O4 — CID 18352913
morpholin-4-yl-[4-[[1-(3-nitrophenyl)propan-2-yl-propylamino]methyl]piperidin-1-yl]methanone (PubChem CID 18352913) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is morpholin-4-yl-[4-[[1-(3-nitrophenyl)propan-2-yl-propylamino]methyl]piperidin-1-yl]methanone.
| Compound Name | morpholin-4-yl-[4-[[1-(3-nitrophenyl)propan-2-yl-propylamino]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 18352913 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | morpholin-4-yl-[4-[[1-(3-nitrophenyl)propan-2-yl-propylamino]methyl]piperidin-1-yl]methanone |
| SMILES | CCCN(CC1CCN(C(=O)N2CCOCC2)CC1)C(C)Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H36N4O4/c1-3-9-26(19(2)16-21-5-4-6-22(17-21)27(29)30)18-20-7-10-24(11-8-20)23(28)25-12-14-31-15-13-25/h4-6,17,19-20H,3,7-16,18H2,1-2H3 |
| InChIKey | HPWQEQUNYOBOEA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|