C25H42N4O2 — CID 15546289
[4-[[1-[4-(dimethylamino)phenyl]propan-2-yl-propylamino]methyl]piperidin-1-yl]-morpholin-4-ylmethanone (PubChem CID 15546289) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is [4-[[1-[4-(dimethylamino)phenyl]propan-2-yl-propylamino]methyl]piperidin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[1-[4-(dimethylamino)phenyl]propan-2-yl-propylamino]methyl]piperidin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 15546289 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | [4-[[1-[4-(dimethylamino)phenyl]propan-2-yl-propylamino]methyl]piperidin-1-yl]-morpholin-4-ylmethanone |
| SMILES | CCCN(CC1CCN(C(=O)N2CCOCC2)CC1)C(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H42N4O2/c1-5-12-29(21(2)19-22-6-8-24(9-7-22)26(3)4)20-23-10-13-27(14-11-23)25(30)28-15-17-31-18-16-28/h6-9,21,23H,5,10-20H2,1-4H3 |
| InChIKey | DWVPWNNPUAMHHH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|