C37H35N5O6 — CID 18354873
N-[4-[[2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxyphenyl]-2-methyl-1H-benzimidazole-4-carboxamide (PubChem CID 18354873) has the molecular formula C37H35N5O6 and a molecular weight of 645.72 g/mol. Its IUPAC name is N-[4-[[2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxyphenyl]-2-methyl-1H-benzimidazole-4-carboxamide.
| Compound Name | N-[4-[[2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxyphenyl]-2-methyl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 18354873 |
| Molecular Formula | C37H35N5O6 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | N-[4-[[2-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxyphenyl]-2-methyl-1H-benzimidazole-4-carboxamide |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCCCCN2C(=O)c3ccccc3C2=O)ccc1NC(=O)c1cccc2[nH]c(C)nc12 |
| InChI | InChI=1S/C37H35N5O6/c1-22-14-17-30(32(20-22)48-19-8-7-18-42-36(45)25-10-5-6-11-26(25)37(42)46)41(3)35(44)24-15-16-28(31(21-24)47-4)40-34(43)27-12-9-13-29-33(27)39-23(2)38-29/h5-6,9-17,20-21H,7-8,18-19H2,1-4H3,(H,38,39)(H,40,43) |
| InChIKey | HENNHHSJFSZPIU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|