C34H42N8O6 — CID 18355011
N-[4-[acetamido-[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]carbamoyl]-2-methoxyphenyl]-2-(aminomethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 18355011) has the molecular formula C34H42N8O6 and a molecular weight of 658.76 g/mol. Its IUPAC name is N-[4-[acetamido-[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]carbamoyl]-2-methoxyphenyl]-2-(aminomethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-[4-[acetamido-[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]carbamoyl]-2-methoxyphenyl]-2-(aminomethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 18355011 |
| Molecular Formula | C34H42N8O6 |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | N-[4-[acetamido-[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]carbamoyl]-2-methoxyphenyl]-2-(aminomethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | COc1cc(C(=O)N(NC(C)=O)c2ccc(C)cc2OCCCCCC(=O)NN(C)C)ccc1NC(=O)c1cccc2[nH]c(CN)nc12 |
| InChI | InChI=1S/C34H42N8O6/c1-21-13-16-27(29(18-21)48-17-8-6-7-12-31(44)40-41(3)4)42(39-22(2)43)34(46)23-14-15-25(28(19-23)47-5)37-33(45)24-10-9-11-26-32(24)38-30(20-35)36-26/h9-11,13-16,18-19H,6-8,12,17,20,35H2,1-5H3,(H,36,38)(H,37,45)(H,39,43)(H,40,44) |
| InChIKey | HOWHHITVZKOADH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 184.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|