About [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol
[4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol (PubChem CID 18356979) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol |
| PubChem CID | 18356979 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol |
| SMILES | CC(C)CN1CC(CO)Oc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-10(2)7-14-8-11(9-15)16-13-6-4-3-5-12(13)14/h3-6,10-11,15H,7-9H2,1-2H3 |
| InChIKey | MKDUSVZZPIEWNN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol?
The IUPAC name of [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol (CID 18356979) is [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol.
What is the SMILES notation for [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol?
The canonical SMILES for [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol is CC(C)CN1CC(CO)Oc2ccccc21.
What is the InChIKey of [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol?
The InChIKey is MKDUSVZZPIEWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-10(2)7-14-8-11(9-15)16-13-6-4-3-5-12(13)14/h3-6,10-11,15H,7-9H2,1-2H3.
What are the key properties of [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol?
[4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol has a molecular weight of 221.30 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-2-yl]methanol is sourced from PubChem (CID 18356979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).