C30H54O12Ti — CID 18358722
bis(3-oxo-2,2,4-tri(propan-2-yloxy)hexanoate);titanium(2+) (PubChem CID 18358722) has the molecular formula C30H54O12Ti and a molecular weight of 654.62 g/mol. Its IUPAC name is bis(3-oxo-2,2,4-tri(propan-2-yloxy)hexanoate);titanium(2+).
| Compound Name | bis(3-oxo-2,2,4-tri(propan-2-yloxy)hexanoate);titanium(2+) |
|---|---|
| PubChem CID | 18358722 |
| Molecular Formula | C30H54O12Ti |
| Molecular Weight | 654.62 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | bis(3-oxo-2,2,4-tri(propan-2-yloxy)hexanoate);titanium(2+) |
| SMILES | CCC(OC(C)C)C(=O)C(OC(C)C)(OC(C)C)C(=O)[O-].CCC(OC(C)C)C(=O)C(OC(C)C)(OC(C)C)C(=O)[O-].[Ti+2] |
| InChI | InChI=1S/2C15H28O6.Ti/c2*1-8-12(19-9(2)3)13(16)15(14(17)18,20-10(4)5)21-11(6)7;/h2*9-12H,8H2,1-7H3,(H,17,18);/q;;+2/p-2 |
| InChIKey | KQMLCOJSNGHQJR-UHFFFAOYSA-L |
| XLogP | 2.11 |
| TPSA | 169.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|