C18H20N2O5 — CID 18364959
methyl 3-[[1-amino-2-(2-methoxyphenoxy)ethylidene]amino]-4-methoxybenzoate (PubChem CID 18364959) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 3-[[1-amino-2-(2-methoxyphenoxy)ethylidene]amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[[1-amino-2-(2-methoxyphenoxy)ethylidene]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 18364959 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 3-[[1-amino-2-(2-methoxyphenoxy)ethylidene]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(/N=C(\N)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-22-14-9-8-12(18(21)24-3)10-13(14)20-17(19)11-25-16-7-5-4-6-15(16)23-2/h4-10H,11H2,1-3H3,(H2,19,20) |
| InChIKey | ULQPJQIAPNILIZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|