C20H24N2O4 — CID 22663422
methyl 3-[(1-amino-4-methoxy-2-phenylbutylidene)amino]-4-methoxybenzoate (PubChem CID 22663422) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 3-[(1-amino-4-methoxy-2-phenylbutylidene)amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[(1-amino-4-methoxy-2-phenylbutylidene)amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 22663422 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 3-[(1-amino-4-methoxy-2-phenylbutylidene)amino]-4-methoxybenzoate |
| SMILES | COCCC(/C(N)=N/c1cc(C(=O)OC)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-24-12-11-16(14-7-5-4-6-8-14)19(21)22-17-13-15(20(23)26-3)9-10-18(17)25-2/h4-10,13,16H,11-12H2,1-3H3,(H2,21,22) |
| InChIKey | GQKNZWDAPOADRJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|