About tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+)
tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) (PubChem CID 18368685) has the molecular formula C9H14ClOV+
and a molecular weight of 224.61 g/mol. Its IUPAC name is tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+).
Molecular Properties
| Compound Name | tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) |
| PubChem CID | 18368685 |
| Molecular Formula | C9H14ClOV+ |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) |
| SMILES | CC(C)(C)OCl.[C-]1=CC=CC1.[V+2] |
| InChI | InChI=1S/C5H5.C4H9ClO.V/c1-2-4-5-3-1;1-4(2,3)6-5;/h1-3H,4H2;1-3H3;/q-1;;+2 |
| InChIKey | QYCRYOSJDVDLSZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+)?
The IUPAC name of tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) (CID 18368685) is tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+).
What is the SMILES notation for tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+)?
The canonical SMILES for tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) is CC(C)(C)OCl.[C-]1=CC=CC1.[V+2].
What is the InChIKey of tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+)?
The InChIKey is QYCRYOSJDVDLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.C4H9ClO.V/c1-2-4-5-3-1;1-4(2,3)6-5;/h1-3H,4H2;1-3H3;/q-1;;+2.
What are the key properties of tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+)?
tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) has a molecular weight of 224.61 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl hypochlorite;cyclopenta-1,3-diene;vanadium(2+) is sourced from PubChem (CID 18368685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).