C27H26N6O9 — CID 18369282
ethyl 3-ethoxy-7-[5-[(2-ethoxycarbonylphenyl)carbamoyloxymethyl]-1H-imidazol-2-yl]-6-nitroquinoxaline-2-carboxylate (PubChem CID 18369282) has the molecular formula C27H26N6O9 and a molecular weight of 578.54 g/mol. Its IUPAC name is ethyl 3-ethoxy-7-[5-[(2-ethoxycarbonylphenyl)carbamoyloxymethyl]-1H-imidazol-2-yl]-6-nitroquinoxaline-2-carboxylate.
| Compound Name | ethyl 3-ethoxy-7-[5-[(2-ethoxycarbonylphenyl)carbamoyloxymethyl]-1H-imidazol-2-yl]-6-nitroquinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 18369282 |
| Molecular Formula | C27H26N6O9 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | ethyl 3-ethoxy-7-[5-[(2-ethoxycarbonylphenyl)carbamoyloxymethyl]-1H-imidazol-2-yl]-6-nitroquinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)OCc1cnc(-c2cc3nc(C(=O)OCC)c(OCC)nc3cc2[N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C27H26N6O9/c1-4-39-24-22(26(35)41-6-3)30-19-11-17(21(33(37)38)12-20(19)31-24)23-28-13-15(29-23)14-42-27(36)32-18-10-8-7-9-16(18)25(34)40-5-2/h7-13H,4-6,14H2,1-3H3,(H,28,29)(H,32,36) |
| InChIKey | IXCKPFRLNGKENS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 197.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|