C25H21ClN2O3 — CID 18369317
2-[(4-chlorophenyl)methyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one (PubChem CID 18369317) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 18369317 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| SMILES | COc1ccc(-c2cc(=O)n(Cc3ccc(Cl)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-30-21-11-5-18(6-12-21)23-15-24(29)28(16-17-3-9-20(26)10-4-17)27-25(23)19-7-13-22(31-2)14-8-19/h3-15H,16H2,1-2H3 |
| InChIKey | ZZXQPJDRCSMCCC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |