C9H8F8O2 — CID 18369740
2-(difluoromethylidene)-3,3,4,4,5,5-hexafluorooctanoic acid (PubChem CID 18369740) has the molecular formula C9H8F8O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-(difluoromethylidene)-3,3,4,4,5,5-hexafluorooctanoic acid.
| Compound Name | 2-(difluoromethylidene)-3,3,4,4,5,5-hexafluorooctanoic acid |
|---|---|
| PubChem CID | 18369740 |
| Molecular Formula | C9H8F8O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(difluoromethylidene)-3,3,4,4,5,5-hexafluorooctanoic acid |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(C(=O)O)=C(F)F |
| InChI | InChI=1S/C9H8F8O2/c1-2-3-7(12,13)9(16,17)8(14,15)4(5(10)11)6(18)19/h2-3H2,1H3,(H,18,19) |
| InChIKey | BYWPSMQELKWPBW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|