C14H19NO4 — CID 18370792
ethyl (2E)-2-hydroxyimino-5-(3-methoxyphenyl)pentanoate (PubChem CID 18370792) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl (2E)-2-hydroxyimino-5-(3-methoxyphenyl)pentanoate.
| Compound Name | ethyl (2E)-2-hydroxyimino-5-(3-methoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 18370792 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl (2E)-2-hydroxyimino-5-(3-methoxyphenyl)pentanoate |
| SMILES | CCOC(=O)/C(CCCc1cccc(OC)c1)=N/O |
| InChI | InChI=1S/C14H19NO4/c1-3-19-14(16)13(15-17)9-5-7-11-6-4-8-12(10-11)18-2/h4,6,8,10,17H,3,5,7,9H2,1-2H3/b15-13+ |
| InChIKey | FEQDGEDBIYGPLY-FYWRMAATSA-N |
| XLogP | 2.41 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|