C10H19NO3 — CID 18370813
ethyl (2E)-2-hydroxyimino-5,5-dimethylhexanoate (PubChem CID 18370813) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is ethyl (2E)-2-hydroxyimino-5,5-dimethylhexanoate.
| Compound Name | ethyl (2E)-2-hydroxyimino-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 18370813 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethyl (2E)-2-hydroxyimino-5,5-dimethylhexanoate |
| SMILES | CCOC(=O)/C(CCC(C)(C)C)=N/O |
| InChI | InChI=1S/C10H19NO3/c1-5-14-9(12)8(11-13)6-7-10(2,3)4/h13H,5-7H2,1-4H3/b11-8+ |
| InChIKey | HZRNGJMOTBGMDK-DHZHZOJOSA-N |
| XLogP | 2.21 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|