cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate

C16H30N2O2 — CID 18372793

IUPACcyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate
SMILESCCCN(C(=O)OCC1CCCCC1)C1CCNCC1
InChIInChI=1S/C16H30N2O2/c1-2-12-18(15-8-10-17-11-9-15)16(19)20-13-14-6-4-3-5-7-14/h14-15,17H,2-13H2,1H3
InChIKeySAWYQTUUQJWIQJ-UHFFFAOYSA-N
MW282.43 g/mol
LogP3.17
Rot. Bonds5

About cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate

cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate (PubChem CID 18372793) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate.

Molecular Properties

Compound Namecyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate
PubChem CID18372793
Molecular FormulaC16H30N2O2
Molecular Weight282.43 g/mol
Exact Mass282.23
IUPAC Namecyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate
SMILESCCCN(C(=O)OCC1CCCCC1)C1CCNCC1
InChIInChI=1S/C16H30N2O2/c1-2-12-18(15-8-10-17-11-9-15)16(19)20-13-14-6-4-3-5-7-14/h14-15,17H,2-13H2,1H3
InChIKeySAWYQTUUQJWIQJ-UHFFFAOYSA-N
XLogP3.17
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.43
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate?
The IUPAC name of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate (CID 18372793) is cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate.
What is the SMILES notation for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate?
The canonical SMILES for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate is CCCN(C(=O)OCC1CCCCC1)C1CCNCC1.
What is the InChIKey of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate?
The InChIKey is SAWYQTUUQJWIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2/c1-2-12-18(15-8-10-17-11-9-15)16(19)20-13-14-6-4-3-5-7-14/h14-15,17H,2-13H2,1H3.
What are the key properties of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate?
cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate has a molecular weight of 282.43 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate is sourced from PubChem (CID 18372793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).