About 1,1-diethylimidazol-1-ium
1,1-diethylimidazol-1-ium (PubChem CID 18377234) has the molecular formula C7H13N2+
and a molecular weight of 125.19 g/mol. Its IUPAC name is 1,1-diethylimidazol-1-ium.
Molecular Properties
| Compound Name | 1,1-diethylimidazol-1-ium |
| PubChem CID | 18377234 |
| Molecular Formula | C7H13N2+ |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 1,1-diethylimidazol-1-ium |
| SMILES | CC[N+]1(CC)C=CN=C1 |
| InChI | InChI=1S/C7H13N2/c1-3-9(4-2)6-5-8-7-9/h5-7H,3-4H2,1-2H3/q+1 |
| InChIKey | DRSXKBDJDCLFIV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylimidazol-1-ium?
The IUPAC name of 1,1-diethylimidazol-1-ium (CID 18377234) is 1,1-diethylimidazol-1-ium.
What is the SMILES notation for 1,1-diethylimidazol-1-ium?
The canonical SMILES for 1,1-diethylimidazol-1-ium is CC[N+]1(CC)C=CN=C1.
What is the InChIKey of 1,1-diethylimidazol-1-ium?
The InChIKey is DRSXKBDJDCLFIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2/c1-3-9(4-2)6-5-8-7-9/h5-7H,3-4H2,1-2H3/q+1.
What are the key properties of 1,1-diethylimidazol-1-ium?
1,1-diethylimidazol-1-ium has a molecular weight of 125.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylimidazol-1-ium is sourced from PubChem (CID 18377234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).