C7H13BrN2 — CID 139210624
1-ethyl-1,2-dimethylimidazol-1-ium bromide (PubChem CID 139210624) has the molecular formula C7H13BrN2 and a molecular weight of 205.10 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethylimidazol-1-ium bromide.
| Compound Name | 1-ethyl-1,2-dimethylimidazol-1-ium bromide |
|---|---|
| PubChem CID | 139210624 |
| Molecular Formula | C7H13BrN2 |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1-ethyl-1,2-dimethylimidazol-1-ium bromide |
| SMILES | CC[N+]1(C)C=CN=C1C.[Br-] |
| InChI | InChI=1S/C7H13N2.BrH/c1-4-9(3)6-5-8-7(9)2;/h5-6H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QQPAZPLWPDPFGU-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|