C24H33ClN2O — CID 18381542
N-(1-adamantylmethyl)-2-chloro-5-(piperidin-4-ylmethyl)benzamide (PubChem CID 18381542) has the molecular formula C24H33ClN2O and a molecular weight of 400.99 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-(piperidin-4-ylmethyl)benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-(piperidin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18381542 |
| Molecular Formula | C24H33ClN2O |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-(piperidin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(CC2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C24H33ClN2O/c25-22-2-1-17(7-16-3-5-26-6-4-16)11-21(22)23(28)27-15-24-12-18-8-19(13-24)10-20(9-18)14-24/h1-2,11,16,18-20,26H,3-10,12-15H2,(H,27,28) |
| InChIKey | VPHJZPZBRPTDJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |