C26H25N5OS — CID 18382993
N-[2-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]ethyl]acetamide (PubChem CID 18382993) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is N-[2-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 18382993 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[2-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(-c2cc3nccc(Nc4ccc5[nH]ccc5c4)c3s2)cc1 |
| InChI | InChI=1S/C26H25N5OS/c1-17(32)28-13-12-27-16-18-2-4-19(5-3-18)25-15-24-26(33-25)23(9-11-30-24)31-21-6-7-22-20(14-21)8-10-29-22/h2-11,14-15,27,29H,12-13,16H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | UGWUUDYHNSCFBW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|