C24H29N7O — CID 18384412
4-pentyl-1-propan-2-yl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one (PubChem CID 18384412) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-pentyl-1-propan-2-yl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 4-pentyl-1-propan-2-yl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 18384412 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 4-pentyl-1-propan-2-yl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCc1cn(C(C)C)c(=O)n1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H29N7O/c1-4-5-6-8-20-16-30(17(2)3)24(32)31(20)15-18-10-12-19(13-11-18)22-21(9-7-14-25-22)23-26-28-29-27-23/h7,9-14,16-17H,4-6,8,15H2,1-3H3,(H,26,27,28,29) |
| InChIKey | XCUOEWSAPBHDIG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|