C22H25N7O — CID 18384633
1-methyl-4-pentyl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one (PubChem CID 18384633) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-methyl-4-pentyl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 1-methyl-4-pentyl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 18384633 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-methyl-4-pentyl-3-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCc1cn(C)c(=O)n1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C22H25N7O/c1-3-4-5-7-18-15-28(2)22(30)29(18)14-16-9-11-17(12-10-16)20-19(8-6-13-23-20)21-24-26-27-25-21/h6,8-13,15H,3-5,7,14H2,1-2H3,(H,24,25,26,27) |
| InChIKey | WVHXCNWUXIRNQB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|