C9H17Cl2N5 — CID 18386539
1-amino-1-(2-aminophenyl)-3,3-dimethylguanidine;dihydrochloride (PubChem CID 18386539) has the molecular formula C9H17Cl2N5 and a molecular weight of 266.18 g/mol. Its IUPAC name is 1-amino-1-(2-aminophenyl)-3,3-dimethylguanidine;dihydrochloride.
| Compound Name | 1-amino-1-(2-aminophenyl)-3,3-dimethylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 18386539 |
| Molecular Formula | C9H17Cl2N5 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-amino-1-(2-aminophenyl)-3,3-dimethylguanidine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N(C)C)N(N)c1ccccc1N |
| InChI | InChI=1S/C9H15N5.2ClH/c1-13(2)9(11)14(12)8-6-4-3-5-7(8)10;;/h3-6,11H,10,12H2,1-2H3;2*1H/b11-9+;; |
| InChIKey | BHGATIIDNBOEIT-OTBYXNOXSA-N |
| XLogP | 1.29 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|