C13H21NO — CID 18389193
1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-ol (PubChem CID 18389193) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-ol.
| Compound Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 18389193 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(C[C@H]2C[C@H]3C=C[C@@H]2C3)CC1 |
| InChI | InChI=1S/C13H21NO/c15-13-3-5-14(6-4-13)9-12-8-10-1-2-11(12)7-10/h1-2,10-13,15H,3-9H2/t10-,11+,12+/m0/s1 |
| InChIKey | UWPSQQFDOPUEJL-QJPTWQEYSA-N |
| XLogP | 1.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|