C16H23N3 — CID 124572355
1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1H-pyrazol-5-yl)piperidine (PubChem CID 124572355) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1H-pyrazol-5-yl)piperidine.
| Compound Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 124572355 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(1H-pyrazol-5-yl)piperidine |
| SMILES | C1=C[C@H]2C[C@H]1C[C@H]2CN1CCC(c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C16H23N3/c1-2-14-9-12(1)10-15(14)11-19-7-4-13(5-8-19)16-3-6-17-18-16/h1-3,6,12-15H,4-5,7-11H2,(H,17,18)/t12-,14-,15-/m0/s1 |
| InChIKey | ZLMKDPRYBUWGQZ-QEJZJMRPSA-N |
| XLogP | 2.80 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|