C16H15N2O6- — CID 18389197
(1R,2S,3S,4R)-3-[(2-methoxy-5-nitrophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18389197) has the molecular formula C16H15N2O6- and a molecular weight of 331.30 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[(2-methoxy-5-nitrophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3S,4R)-3-[(2-methoxy-5-nitrophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18389197 |
| Molecular Formula | C16H15N2O6- |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (1R,2S,3S,4R)-3-[(2-methoxy-5-nitrophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H16N2O6/c1-24-12-5-4-10(18(22)23)7-11(12)17-15(19)13-8-2-3-9(6-8)14(13)16(20)21/h2-5,7-9,13-14H,6H2,1H3,(H,17,19)(H,20,21)/p-1/t8-,9-,13-,14-/m0/s1 |
| InChIKey | AQJMIPJCUWITQP-WBRVRECLSA-M |
| XLogP | 0.73 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|