C15H14ClN2O6- — CID 7428479
(1S,6R)-4-chloro-6-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7428479) has the molecular formula C15H14ClN2O6- and a molecular weight of 353.74 g/mol. Its IUPAC name is (1S,6R)-4-chloro-6-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-4-chloro-6-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7428479 |
| Molecular Formula | C15H14ClN2O6- |
| Molecular Weight | 353.74 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (1S,6R)-4-chloro-6-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CC(Cl)=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H15ClN2O6/c1-24-13-5-3-9(18(22)23)7-12(13)17-14(19)11-6-8(16)2-4-10(11)15(20)21/h2-3,5,7,10-11H,4,6H2,1H3,(H,17,19)(H,20,21)/p-1/t10-,11+/m0/s1 |
| InChIKey | DHZWDJJUPAFQHR-WDEREUQCSA-M |
| XLogP | 1.44 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.74 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|