C24H27NO5 — CID 18394446
9H-fluoren-9-ylmethoxycarbonyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate (PubChem CID 18394446) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethoxycarbonyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethoxycarbonyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 18394446 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 9H-fluoren-9-ylmethoxycarbonyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)O[C@H]1CN[C@H](C(=O)OC(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C24H27NO5/c1-24(2,3)30-15-12-21(25-13-15)22(26)29-23(27)28-14-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,15,20-21,25H,12-14H2,1-3H3/t15-,21+/m1/s1 |
| InChIKey | MXKWHOXPJDNWHG-VFNWGFHPSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|