C21H29F3O4 — CID 18397090
[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 6-hydroxy-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 18397090) has the molecular formula C21H29F3O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 6-hydroxy-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 6-hydroxy-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18397090 |
| Molecular Formula | C21H29F3O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 6-hydroxy-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOCCCCC[C@@H](OC(=O)C1CCc2cc(O)ccc2C1C)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O4/c1-3-27-12-6-4-5-7-19(21(22,23)24)28-20(26)18-10-8-15-13-16(25)9-11-17(15)14(18)2/h9,11,13-14,18-19,25H,3-8,10,12H2,1-2H3/t14?,18?,19-/m1/s1 |
| InChIKey | JVXUZNIBJMLZJL-DNOPENIRSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|