C8H8N2O2 — CID 18398305
4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile (PubChem CID 18398305) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18398305 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile |
| SMILES | CCc1cc(=O)[nH]c(O)c1C#N |
| InChI | InChI=1S/C8H8N2O2/c1-2-5-3-7(11)10-8(12)6(5)4-9/h3H,2H2,1H3,(H2,10,11,12) |
| InChIKey | WQMPZIYHTPLJJD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |