C27H27ClN2O7 — CID 18399224
methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-7-hydroxy-6-methoxy-1-oxoisoquinoline-3-carboxylate;hydrochloride (PubChem CID 18399224) has the molecular formula C27H27ClN2O7 and a molecular weight of 526.97 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-7-hydroxy-6-methoxy-1-oxoisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-7-hydroxy-6-methoxy-1-oxoisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18399224 |
| Molecular Formula | C27H27ClN2O7 |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-7-hydroxy-6-methoxy-1-oxoisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(C)c(OC)c2)c2cc(OC)c(O)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C27H26N2O7.ClH/c1-14-21(33-2)10-15(11-22(14)34-3)24-18-13-23(35-4)20(30)12-19(18)26(31)29(25(24)27(32)36-5)17-8-6-16(28)7-9-17;/h6-13,30H,28H2,1-5H3;1H |
| InChIKey | ZZGXQHHFHBJHMM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|