C27H31N3O4 — CID 18403871
ethyl 2-[2-phenylmethoxy-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetate (PubChem CID 18403871) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is ethyl 2-[2-phenylmethoxy-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-phenylmethoxy-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 18403871 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | ethyl 2-[2-phenylmethoxy-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(CN2CCN(c3ccccn3)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O4/c1-2-32-27(31)21-34-25-18-23(11-12-24(25)33-20-22-8-4-3-5-9-22)19-29-14-16-30(17-15-29)26-10-6-7-13-28-26/h3-13,18H,2,14-17,19-21H2,1H3 |
| InChIKey | JUXZLJQATVZANO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |