C24H26N6O2S2 — CID 18404205
2-[[3-methyl-4-[2-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]ethylsulfanyl]-2-pyridinyl]methyl]quinolin-3-amine (PubChem CID 18404205) has the molecular formula C24H26N6O2S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 2-[[3-methyl-4-[2-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]ethylsulfanyl]-2-pyridinyl]methyl]quinolin-3-amine.
| Compound Name | 2-[[3-methyl-4-[2-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]ethylsulfanyl]-2-pyridinyl]methyl]quinolin-3-amine |
|---|---|
| PubChem CID | 18404205 |
| Molecular Formula | C24H26N6O2S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[[3-methyl-4-[2-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]ethylsulfanyl]-2-pyridinyl]methyl]quinolin-3-amine |
| SMILES | Cc1c(SCCSCCn2c([N+](=O)[O-])cnc2C)ccnc1Cc1nc2ccccc2cc1N |
| InChI | InChI=1S/C24H26N6O2S2/c1-16-21(14-22-19(25)13-18-5-3-4-6-20(18)28-22)26-8-7-23(16)34-12-11-33-10-9-29-17(2)27-15-24(29)30(31)32/h3-8,13,15H,9-12,14,25H2,1-2H3 |
| InChIKey | IYTRXABHGPJTPX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|