C32H26N2O6 — CID 18405731
2-[N-acetyl-4-(N-acetyl-4-carboxyanilino)anilino]-5-[(E)-2-phenylethenyl]benzoic acid (PubChem CID 18405731) has the molecular formula C32H26N2O6 and a molecular weight of 534.57 g/mol. Its IUPAC name is 2-[N-acetyl-4-(N-acetyl-4-carboxyanilino)anilino]-5-[(E)-2-phenylethenyl]benzoic acid.
| Compound Name | 2-[N-acetyl-4-(N-acetyl-4-carboxyanilino)anilino]-5-[(E)-2-phenylethenyl]benzoic acid |
|---|---|
| PubChem CID | 18405731 |
| Molecular Formula | C32H26N2O6 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[N-acetyl-4-(N-acetyl-4-carboxyanilino)anilino]-5-[(E)-2-phenylethenyl]benzoic acid |
| SMILES | CC(=O)N(c1ccc(C(=O)O)cc1)c1ccc(N(C(C)=O)c2ccc(/C=C/c3ccccc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C32H26N2O6/c1-21(35)33(26-13-11-25(12-14-26)31(37)38)27-15-17-28(18-16-27)34(22(2)36)30-19-10-24(20-29(30)32(39)40)9-8-23-6-4-3-5-7-23/h3-20H,1-2H3,(H,37,38)(H,39,40)/b9-8+ |
| InChIKey | JTUFBQJZYIMYKF-CMDGGOBGSA-N |
| XLogP | 6.62 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|