C31H24N2O6 — CID 70119233
2-[[4-(N-acetyl-4-carboxyanilino)benzoyl]amino]-5-(2-phenylethenyl)benzoic acid (PubChem CID 70119233) has the molecular formula C31H24N2O6 and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-[[4-(N-acetyl-4-carboxyanilino)benzoyl]amino]-5-(2-phenylethenyl)benzoic acid.
| Compound Name | 2-[[4-(N-acetyl-4-carboxyanilino)benzoyl]amino]-5-(2-phenylethenyl)benzoic acid |
|---|---|
| PubChem CID | 70119233 |
| Molecular Formula | C31H24N2O6 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[[4-(N-acetyl-4-carboxyanilino)benzoyl]amino]-5-(2-phenylethenyl)benzoic acid |
| SMILES | CC(=O)N(c1ccc(C(=O)O)cc1)c1ccc(C(=O)Nc2ccc(C=Cc3ccccc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H24N2O6/c1-20(34)33(26-16-12-24(13-17-26)30(36)37)25-14-10-23(11-15-25)29(35)32-28-18-9-22(19-27(28)31(38)39)8-7-21-5-3-2-4-6-21/h2-19H,1H3,(H,32,35)(H,36,37)(H,38,39) |
| InChIKey | BWCDHVOTUOYKCP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|