C34H30N2O7 — CID 10281682
methyl 2-[[4-[(4-methoxycarbonylbenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzoate (PubChem CID 10281682) has the molecular formula C34H30N2O7 and a molecular weight of 578.62 g/mol. Its IUPAC name is methyl 2-[[4-[(4-methoxycarbonylbenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzoate.
| Compound Name | methyl 2-[[4-[(4-methoxycarbonylbenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 10281682 |
| Molecular Formula | C34H30N2O7 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | methyl 2-[[4-[(4-methoxycarbonylbenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(C)c2ccc(C(=O)Nc3ccc(/C=C/c4ccc(OC)cc4)cc3C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C34H30N2O7/c1-36(32(38)25-10-12-26(13-11-25)33(39)42-3)27-16-14-24(15-17-27)31(37)35-30-20-9-23(21-29(30)34(40)43-4)6-5-22-7-18-28(41-2)19-8-22/h5-21H,1-4H3,(H,35,37)/b6-5+ |
| InChIKey | FJEZTHJYNWFFKT-AATRIKPKSA-N |
| XLogP | 5.97 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|