C31H23FN2O6 — CID 10119584
2-[[4-[(4-carboxybenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(2-fluorophenyl)ethenyl]benzoic acid (PubChem CID 10119584) has the molecular formula C31H23FN2O6 and a molecular weight of 538.53 g/mol. Its IUPAC name is 2-[[4-[(4-carboxybenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(2-fluorophenyl)ethenyl]benzoic acid.
| Compound Name | 2-[[4-[(4-carboxybenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(2-fluorophenyl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 10119584 |
| Molecular Formula | C31H23FN2O6 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-[[4-[(4-carboxybenzoyl)-methylamino]benzoyl]amino]-5-[(E)-2-(2-fluorophenyl)ethenyl]benzoic acid |
| SMILES | CN(C(=O)c1ccc(C(=O)O)cc1)c1ccc(C(=O)Nc2ccc(/C=C/c3ccccc3F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H23FN2O6/c1-34(29(36)22-9-11-23(12-10-22)30(37)38)24-15-13-21(14-16-24)28(35)33-27-17-7-19(18-25(27)31(39)40)6-8-20-4-2-3-5-26(20)32/h2-18H,1H3,(H,33,35)(H,37,38)(H,39,40)/b8-6+ |
| InChIKey | QLTOJUKWXJAWHN-SOFGYWHQSA-N |
| XLogP | 5.92 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|