C37H27NO8 — CID 91523326
2-[[3,5-bis(4-carboxyphenyl)-2-methoxybenzoyl]amino]-5-(2-phenylethenyl)benzoic acid (PubChem CID 91523326) has the molecular formula C37H27NO8 and a molecular weight of 613.62 g/mol. Its IUPAC name is 2-[[3,5-bis(4-carboxyphenyl)-2-methoxybenzoyl]amino]-5-(2-phenylethenyl)benzoic acid.
| Compound Name | 2-[[3,5-bis(4-carboxyphenyl)-2-methoxybenzoyl]amino]-5-(2-phenylethenyl)benzoic acid |
|---|---|
| PubChem CID | 91523326 |
| Molecular Formula | C37H27NO8 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 2-[[3,5-bis(4-carboxyphenyl)-2-methoxybenzoyl]amino]-5-(2-phenylethenyl)benzoic acid |
| SMILES | COc1c(C(=O)Nc2ccc(C=Cc3ccccc3)cc2C(=O)O)cc(-c2ccc(C(=O)O)cc2)cc1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C37H27NO8/c1-46-33-29(25-12-16-27(17-13-25)36(42)43)20-28(24-10-14-26(15-11-24)35(40)41)21-31(33)34(39)38-32-18-9-23(19-30(32)37(44)45)8-7-22-5-3-2-4-6-22/h2-21H,1H3,(H,38,39)(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | PWWRRCMMPAWMME-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|