C31H22O2 — CID 86302393
4-[(E)-2-(5,8-diphenylnaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 86302393) has the molecular formula C31H22O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[(E)-2-(5,8-diphenylnaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-(5,8-diphenylnaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 86302393 |
| Molecular Formula | C31H22O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[(E)-2-(5,8-diphenylnaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/c2ccc3c(-c4ccccc4)ccc(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C31H22O2/c32-31(33)26-16-13-22(14-17-26)11-12-23-15-18-29-27(24-7-3-1-4-8-24)19-20-28(30(29)21-23)25-9-5-2-6-10-25/h1-21H,(H,32,33)/b12-11+ |
| InChIKey | YQGZYHZTJDOJQB-VAWYXSNFSA-N |
| XLogP | 8.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|