C12H7F15O2 — CID 18407409
2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoroundecanoic acid (PubChem CID 18407409) has the molecular formula C12H7F15O2 and a molecular weight of 468.16 g/mol. Its IUPAC name is 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoroundecanoic acid.
| Compound Name | 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoroundecanoic acid |
|---|---|
| PubChem CID | 18407409 |
| Molecular Formula | C12H7F15O2 |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluoroundecanoic acid |
| SMILES | CCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(=O)O)=C(F)F |
| InChI | InChI=1S/C12H7F15O2/c1-2-3(13)7(16,17)9(20,21)11(24,25)12(26,27)10(22,23)8(18,19)4(5(14)15)6(28)29/h3H,2H2,1H3,(H,28,29) |
| InChIKey | SKSSCVOTRHBMGG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|