C25H20BrN3O4 — CID 18408659
N-benzyl-2-(3-bromophenyl)-N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)acetamide (PubChem CID 18408659) has the molecular formula C25H20BrN3O4 and a molecular weight of 506.36 g/mol. Its IUPAC name is N-benzyl-2-(3-bromophenyl)-N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)acetamide.
| Compound Name | N-benzyl-2-(3-bromophenyl)-N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)acetamide |
|---|---|
| PubChem CID | 18408659 |
| Molecular Formula | C25H20BrN3O4 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-benzyl-2-(3-bromophenyl)-N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)acetamide |
| SMILES | O=C1NC(=O)C(c2ccccc2)(N(Cc2ccccc2)C(=O)Cc2cccc(Br)c2)C(=O)N1 |
| InChI | InChI=1S/C25H20BrN3O4/c26-20-13-7-10-18(14-20)15-21(30)29(16-17-8-3-1-4-9-17)25(19-11-5-2-6-12-19)22(31)27-24(33)28-23(25)32/h1-14H,15-16H2,(H2,27,28,31,32,33) |
| InChIKey | KTXJOAAGLNHOJJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|